About 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one
5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one (PubChem CID 106668453) has the molecular formula C9H16ClNO3
and a molecular weight of 221.68 g/mol. Its IUPAC name is 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one.
Molecular Properties
| Compound Name | 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one |
| PubChem CID | 106668453 |
| Molecular Formula | C9H16ClNO3 |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one |
| SMILES | O=C(CCCCCl)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C9H16ClNO3/c10-4-2-1-3-9(14)11-5-7(12)8(13)6-11/h7-8,12-13H,1-6H2 |
| InChIKey | NSYLLUJVSKKQJY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one?
The IUPAC name of 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one (CID 106668453) is 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one.
What is the SMILES notation for 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one?
The canonical SMILES for 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one is O=C(CCCCCl)N1CC(O)C(O)C1.
What is the InChIKey of 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one?
The InChIKey is NSYLLUJVSKKQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNO3/c10-4-2-1-3-9(14)11-5-7(12)8(13)6-11/h7-8,12-13H,1-6H2.
What are the key properties of 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one?
5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one has a molecular weight of 221.68 g/mol, XLogP of -0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one is sourced from PubChem (CID 106668453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).