C9H16ClNO3 — CID 106668453
5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one (PubChem CID 106668453) has the molecular formula C9H16ClNO3 and a molecular weight of 221.68 g/mol. Its IUPAC name is 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one.
| Compound Name | 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 106668453 |
| Molecular Formula | C9H16ClNO3 |
| Molecular Weight | 221.68 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 5-chloro-1-(3,4-dihydroxypyrrolidin-1-yl)pentan-1-one |
| SMILES | O=C(CCCCCl)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C9H16ClNO3/c10-4-2-1-3-9(14)11-5-7(12)8(13)6-11/h7-8,12-13H,1-6H2 |
| InChIKey | NSYLLUJVSKKQJY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.68 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|