C11H20ClNO2 — CID 62986786
5-chloro-1-(2-methyl-1,4-oxazepan-4-yl)pentan-1-one (PubChem CID 62986786) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 5-chloro-1-(2-methyl-1,4-oxazepan-4-yl)pentan-1-one.
| Compound Name | 5-chloro-1-(2-methyl-1,4-oxazepan-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 62986786 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-chloro-1-(2-methyl-1,4-oxazepan-4-yl)pentan-1-one |
| SMILES | CC1CN(C(=O)CCCCCl)CCCO1 |
| InChI | InChI=1S/C11H20ClNO2/c1-10-9-13(7-4-8-15-10)11(14)5-2-3-6-12/h10H,2-9H2,1H3 |
| InChIKey | SZKJHHQUQJAZGM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|