C13H26N2O2 — CID 114218375
6-amino-1-(2-ethyl-1,4-oxazepan-4-yl)hexan-1-one (PubChem CID 114218375) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 6-amino-1-(2-ethyl-1,4-oxazepan-4-yl)hexan-1-one.
| Compound Name | 6-amino-1-(2-ethyl-1,4-oxazepan-4-yl)hexan-1-one |
|---|---|
| PubChem CID | 114218375 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 6-amino-1-(2-ethyl-1,4-oxazepan-4-yl)hexan-1-one |
| SMILES | CCC1CN(C(=O)CCCCCN)CCCO1 |
| InChI | InChI=1S/C13H26N2O2/c1-2-12-11-15(9-6-10-17-12)13(16)7-4-3-5-8-14/h12H,2-11,14H2,1H3 |
| InChIKey | WBTJKPIILAYOAI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|