About 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone
2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone (PubChem CID 130485475) has the molecular formula C9H16ClNO2
and a molecular weight of 205.68 g/mol. Its IUPAC name is 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone.
Molecular Properties
| Compound Name | 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone |
| PubChem CID | 130485475 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone |
| SMILES | CCC1CN(C(=O)CCl)CCCO1 |
| InChI | InChI=1S/C9H16ClNO2/c1-2-8-7-11(9(12)6-10)4-3-5-13-8/h8H,2-7H2,1H3 |
| InChIKey | YPNQVYIELBREHJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone?
The IUPAC name of 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone (CID 130485475) is 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone.
What is the SMILES notation for 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone?
The canonical SMILES for 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone is CCC1CN(C(=O)CCl)CCCO1.
What is the InChIKey of 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone?
The InChIKey is YPNQVYIELBREHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClNO2/c1-2-8-7-11(9(12)6-10)4-3-5-13-8/h8H,2-7H2,1H3.
What are the key properties of 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone?
2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone has a molecular weight of 205.68 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone is sourced from PubChem (CID 130485475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).