C9H16ClNO2 — CID 130485475
2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone (PubChem CID 130485475) has the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. Its IUPAC name is 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone.
| Compound Name | 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 130485475 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-chloro-1-(2-ethyl-1,4-oxazepan-4-yl)ethanone |
| SMILES | CCC1CN(C(=O)CCl)CCCO1 |
| InChI | InChI=1S/C9H16ClNO2/c1-2-8-7-11(9(12)6-10)4-3-5-13-8/h8H,2-7H2,1H3 |
| InChIKey | YPNQVYIELBREHJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|