C15H20ClNO2 — CID 114218306
[3-(chloromethyl)phenyl]-(2-ethyl-1,4-oxazepan-4-yl)methanone (PubChem CID 114218306) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is [3-(chloromethyl)phenyl]-(2-ethyl-1,4-oxazepan-4-yl)methanone.
| Compound Name | [3-(chloromethyl)phenyl]-(2-ethyl-1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 114218306 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [3-(chloromethyl)phenyl]-(2-ethyl-1,4-oxazepan-4-yl)methanone |
| SMILES | CCC1CN(C(=O)c2cccc(CCl)c2)CCCO1 |
| InChI | InChI=1S/C15H20ClNO2/c1-2-14-11-17(7-4-8-19-14)15(18)13-6-3-5-12(9-13)10-16/h3,5-6,9,14H,2,4,7-8,10-11H2,1H3 |
| InChIKey | QQANYMODVKOGQT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|