C14H18BrNO2 — CID 112705730
(4-bromo-3-methylphenyl)-(2-ethylmorpholin-4-yl)methanone (PubChem CID 112705730) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is (4-bromo-3-methylphenyl)-(2-ethylmorpholin-4-yl)methanone.
| Compound Name | (4-bromo-3-methylphenyl)-(2-ethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 112705730 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (4-bromo-3-methylphenyl)-(2-ethylmorpholin-4-yl)methanone |
| SMILES | CCC1CN(C(=O)c2ccc(Br)c(C)c2)CCO1 |
| InChI | InChI=1S/C14H18BrNO2/c1-3-12-9-16(6-7-18-12)14(17)11-4-5-13(15)10(2)8-11/h4-5,8,12H,3,6-7,9H2,1-2H3 |
| InChIKey | XIJZAAYYQHXFCW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |