C12H24N2O2 — CID 62973457
7-amino-1-(1,4-oxazepan-4-yl)heptan-1-one (PubChem CID 62973457) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 7-amino-1-(1,4-oxazepan-4-yl)heptan-1-one.
| Compound Name | 7-amino-1-(1,4-oxazepan-4-yl)heptan-1-one |
|---|---|
| PubChem CID | 62973457 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 7-amino-1-(1,4-oxazepan-4-yl)heptan-1-one |
| SMILES | NCCCCCCC(=O)N1CCCOCC1 |
| InChI | InChI=1S/C12H24N2O2/c13-7-4-2-1-3-6-12(15)14-8-5-10-16-11-9-14/h1-11,13H2 |
| InChIKey | BUCDGQRJBRORHT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|