C11H22N2OS — CID 61419264
6-amino-1-(1,4-thiazepan-4-yl)hexan-1-one (PubChem CID 61419264) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 6-amino-1-(1,4-thiazepan-4-yl)hexan-1-one.
| Compound Name | 6-amino-1-(1,4-thiazepan-4-yl)hexan-1-one |
|---|---|
| PubChem CID | 61419264 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6-amino-1-(1,4-thiazepan-4-yl)hexan-1-one |
| SMILES | NCCCCCC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C11H22N2OS/c12-6-3-1-2-5-11(14)13-7-4-9-15-10-8-13/h1-10,12H2 |
| InChIKey | QGEADXOXQWDTBU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|