C11H22N2OS — CID 104684861
5-amino-2-methyl-1-(1,4-thiazepan-4-yl)pentan-1-one (PubChem CID 104684861) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 5-amino-2-methyl-1-(1,4-thiazepan-4-yl)pentan-1-one.
| Compound Name | 5-amino-2-methyl-1-(1,4-thiazepan-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 104684861 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 5-amino-2-methyl-1-(1,4-thiazepan-4-yl)pentan-1-one |
| SMILES | CC(CCCN)C(=O)N1CCCSCC1 |
| InChI | InChI=1S/C11H22N2OS/c1-10(4-2-5-12)11(14)13-6-3-8-15-9-7-13/h10H,2-9,12H2,1H3 |
| InChIKey | WLIDSHSPXUXLSG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |