C10H22N4O3S — CID 113440928
4-(5-amino-2-methylpentanoyl)piperazine-1-sulfonamide (PubChem CID 113440928) has the molecular formula C10H22N4O3S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-(5-amino-2-methylpentanoyl)piperazine-1-sulfonamide.
| Compound Name | 4-(5-amino-2-methylpentanoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 113440928 |
| Molecular Formula | C10H22N4O3S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-(5-amino-2-methylpentanoyl)piperazine-1-sulfonamide |
| SMILES | CC(CCCN)C(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C10H22N4O3S/c1-9(3-2-4-11)10(15)13-5-7-14(8-6-13)18(12,16)17/h9H,2-8,11H2,1H3,(H2,12,16,17) |
| InChIKey | HASCIXIUSSFUOD-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |