C9H15NO3S — CID 114898320
2-methyl-3-oxo-3-(1,4-thiazepan-4-yl)propanoic acid (PubChem CID 114898320) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(1,4-thiazepan-4-yl)propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-(1,4-thiazepan-4-yl)propanoic acid |
|---|---|
| PubChem CID | 114898320 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2-methyl-3-oxo-3-(1,4-thiazepan-4-yl)propanoic acid |
| SMILES | CC(C(=O)O)C(=O)N1CCCSCC1 |
| InChI | InChI=1S/C9H15NO3S/c1-7(9(12)13)8(11)10-3-2-5-14-6-4-10/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | CIWLQQVCBPKNOL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|