C12H20N2O3S — CID 173367116
2-methyl-1-morpholin-4-yl-3-thiomorpholin-4-ylpropane-1,3-dione (PubChem CID 173367116) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-methyl-1-morpholin-4-yl-3-thiomorpholin-4-ylpropane-1,3-dione.
| Compound Name | 2-methyl-1-morpholin-4-yl-3-thiomorpholin-4-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 173367116 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-methyl-1-morpholin-4-yl-3-thiomorpholin-4-ylpropane-1,3-dione |
| SMILES | CC(C(=O)N1CCOCC1)C(=O)N1CCSCC1 |
| InChI | InChI=1S/C12H20N2O3S/c1-10(11(15)13-2-6-17-7-3-13)12(16)14-4-8-18-9-5-14/h10H,2-9H2,1H3 |
| InChIKey | WRCVNADIOJLXRF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|