2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid

C14H27N3O3 — CID 62823391

IUPAC2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid
SMILESNCCCCCCC(=O)N1CCCN(CC(=O)O)CC1
InChIInChI=1S/C14H27N3O3/c15-7-4-2-1-3-6-13(18)17-9-5-8-16(10-11-17)12-14(19)20/h1-12,15H2,(H,19,20)
InChIKeySQAHPJQGFDSOII-UHFFFAOYSA-N
MW285.39 g/mol
LogP0.51
Rot. Bonds8

About 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid

2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62823391) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid
PubChem CID62823391
Molecular FormulaC14H27N3O3
Molecular Weight285.39 g/mol
Exact Mass285.21
IUPAC Name2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid
SMILESNCCCCCCC(=O)N1CCCN(CC(=O)O)CC1
InChIInChI=1S/C14H27N3O3/c15-7-4-2-1-3-6-13(18)17-9-5-8-16(10-11-17)12-14(19)20/h1-12,15H2,(H,19,20)
InChIKeySQAHPJQGFDSOII-UHFFFAOYSA-N
XLogP0.51
TPSA86.87 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.39
LogP ≤ 50.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid (CID 62823391) is 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid is NCCCCCCC(=O)N1CCCN(CC(=O)O)CC1.
What is the InChIKey of 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is SQAHPJQGFDSOII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O3/c15-7-4-2-1-3-6-13(18)17-9-5-8-16(10-11-17)12-14(19)20/h1-12,15H2,(H,19,20).
What are the key properties of 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 285.39 g/mol, XLogP of 0.51, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(7-aminoheptanoyl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62823391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).