C16H32N2O5 — CID 4861310
6-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)hexan-1-one (PubChem CID 4861310) has the molecular formula C16H32N2O5 and a molecular weight of 332.44 g/mol. Its IUPAC name is 6-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)hexan-1-one.
| Compound Name | 6-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)hexan-1-one |
|---|---|
| PubChem CID | 4861310 |
| Molecular Formula | C16H32N2O5 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 6-amino-1-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)hexan-1-one |
| SMILES | NCCCCCC(=O)N1CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C16H32N2O5/c17-5-3-1-2-4-16(19)18-6-8-20-10-12-22-14-15-23-13-11-21-9-7-18/h1-15,17H2 |
| InChIKey | KIPCZRLECLUYNM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|