C26H46N2O10 — CID 4584644
methyl 6-[16-(6-methoxy-6-oxohexanoyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-6-oxohexanoate (PubChem CID 4584644) has the molecular formula C26H46N2O10 and a molecular weight of 546.66 g/mol. Its IUPAC name is methyl 6-[16-(6-methoxy-6-oxohexanoyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-6-oxohexanoate.
| Compound Name | methyl 6-[16-(6-methoxy-6-oxohexanoyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 4584644 |
| Molecular Formula | C26H46N2O10 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | methyl 6-[16-(6-methoxy-6-oxohexanoyl)-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)N1CCOCCOCCN(C(=O)CCCCC(=O)OC)CCOCCOCC1 |
| InChI | InChI=1S/C26H46N2O10/c1-33-25(31)9-5-3-7-23(29)27-11-15-35-19-21-37-17-13-28(14-18-38-22-20-36-16-12-27)24(30)8-4-6-10-26(32)34-2/h3-22H2,1-2H3 |
| InChIKey | PMZWKGZPOFCWJG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|