C7H14N2OS — CID 61419104
2-amino-1-(1,4-thiazepan-4-yl)ethanone (PubChem CID 61419104) has the molecular formula C7H14N2OS and a molecular weight of 174.27 g/mol. Its IUPAC name is 2-amino-1-(1,4-thiazepan-4-yl)ethanone.
| Compound Name | 2-amino-1-(1,4-thiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 61419104 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-amino-1-(1,4-thiazepan-4-yl)ethanone |
| SMILES | NCC(=O)N1CCCSCC1 |
| InChI | InChI=1S/C7H14N2OS/c8-6-7(10)9-2-1-4-11-5-3-9/h1-6,8H2 |
| InChIKey | HESWAQMVBBRACZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |