C7H14N2O2 — CID 62973061
2-methyl-1,4-oxazepane-4-carboxamide (PubChem CID 62973061) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-methyl-1,4-oxazepane-4-carboxamide.
| Compound Name | 2-methyl-1,4-oxazepane-4-carboxamide |
|---|---|
| PubChem CID | 62973061 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-methyl-1,4-oxazepane-4-carboxamide |
| SMILES | CC1CN(C(N)=O)CCCO1 |
| InChI | InChI=1S/C7H14N2O2/c1-6-5-9(7(8)10)3-2-4-11-6/h6H,2-5H2,1H3,(H2,8,10) |
| InChIKey | ZZPXNJWYHANOKR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |