C7H15N3O2 — CID 62968526
2-methyl-1,4-oxazepane-4-carbohydrazide (PubChem CID 62968526) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-methyl-1,4-oxazepane-4-carbohydrazide.
| Compound Name | 2-methyl-1,4-oxazepane-4-carbohydrazide |
|---|---|
| PubChem CID | 62968526 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-methyl-1,4-oxazepane-4-carbohydrazide |
| SMILES | CC1CN(C(=O)NN)CCCO1 |
| InChI | InChI=1S/C7H15N3O2/c1-6-5-10(7(11)9-8)3-2-4-12-6/h6H,2-5,8H2,1H3,(H,9,11) |
| InChIKey | NFLKAAAYYUBPKA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|