C7H14N2O — CID 16786142
3-methylpiperidine-1-carboxamide (PubChem CID 16786142) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-methylpiperidine-1-carboxamide.
| Compound Name | 3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 16786142 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C7H14N2O/c1-6-3-2-4-9(5-6)7(8)10/h6H,2-5H2,1H3,(H2,8,10) |
| InChIKey | AHTHIOQYBHDSLX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |