C11H20N4O3 — CID 116655745
N,N-bis(2-amino-2-oxoethyl)-3-methylpiperidine-1-carboxamide (PubChem CID 116655745) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-3-methylpiperidine-1-carboxamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 116655745 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)N(CC(N)=O)CC(N)=O)C1 |
| InChI | InChI=1S/C11H20N4O3/c1-8-3-2-4-14(5-8)11(18)15(6-9(12)16)7-10(13)17/h8H,2-7H2,1H3,(H2,12,16)(H2,13,17) |
| InChIKey | JTWHUVKYVNEJAU-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |