C7H15N3O — CID 166099569
(3R)-N'-hydroxy-3-methylpiperidine-1-carboximidamide (PubChem CID 166099569) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is (3R)-N'-hydroxy-3-methylpiperidine-1-carboximidamide.
| Compound Name | (3R)-N'-hydroxy-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 166099569 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | (3R)-N'-hydroxy-3-methylpiperidine-1-carboximidamide |
| SMILES | C[C@@H]1CCCN(/C(N)=N\O)C1 |
| InChI | InChI=1S/C7H15N3O/c1-6-3-2-4-10(5-6)7(8)9-11/h6,11H,2-5H2,1H3,(H2,8,9)/t6-/m1/s1 |
| InChIKey | HEIXEIODPHUJDD-ZCFIWIBFSA-N |
| XLogP | 0.42 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|