C10H21N3S — CID 100673266
(3R)-3-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide (PubChem CID 100673266) has the molecular formula C10H21N3S and a molecular weight of 215.37 g/mol. Its IUPAC name is (3R)-3-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide.
| Compound Name | (3R)-3-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 100673266 |
| Molecular Formula | C10H21N3S |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (3R)-3-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide |
| SMILES | CSCC/N=C(\N)N1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C10H21N3S/c1-9-4-3-6-13(8-9)10(11)12-5-7-14-2/h9H,3-8H2,1-2H3,(H2,11,12)/t9-/m1/s1 |
| InChIKey | JJDMODXNBTXCOL-SECBINFHSA-N |
| XLogP | 1.40 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|