C17H27N3 — CID 111818646
N'-[2-(3,5-dimethylphenyl)ethyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111818646) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylphenyl)ethyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(3,5-dimethylphenyl)ethyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111818646 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N'-[2-(3,5-dimethylphenyl)ethyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | Cc1cc(C)cc(CC/N=C(\N)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C17H27N3/c1-13-5-4-8-20(12-13)17(18)19-7-6-16-10-14(2)9-15(3)11-16/h9-11,13H,4-8,12H2,1-3H3,(H2,18,19) |
| InChIKey | PIRFNDDOAKJMNG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|