C15H22F2IN3 — CID 110920788
N'-[2-(3,5-difluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 110920788) has the molecular formula C15H22F2IN3 and a molecular weight of 409.26 g/mol. Its IUPAC name is N'-[2-(3,5-difluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(3,5-difluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110920788 |
| Molecular Formula | C15H22F2IN3 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N'-[2-(3,5-difluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CCc2cc(F)cc(F)c2)CC1.I |
| InChI | InChI=1S/C15H21F2N3.HI/c1-11-3-6-20(7-4-11)15(18)19-5-2-12-8-13(16)10-14(17)9-12;/h8-11H,2-7H2,1H3,(H2,18,19);1H |
| InChIKey | OJHTXMIRFSHKJH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|