C13H20BrN3S — CID 110921015
N'-[2-(5-bromothiophen-2-yl)ethyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 110921015) has the molecular formula C13H20BrN3S and a molecular weight of 330.30 g/mol. Its IUPAC name is N'-[2-(5-bromothiophen-2-yl)ethyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(5-bromothiophen-2-yl)ethyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110921015 |
| Molecular Formula | C13H20BrN3S |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N'-[2-(5-bromothiophen-2-yl)ethyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CCc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C13H20BrN3S/c1-10-5-8-17(9-6-10)13(15)16-7-4-11-2-3-12(14)18-11/h2-3,10H,4-9H2,1H3,(H2,15,16) |
| InChIKey | YJCNXGWEKHDOBK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|