C17H24N4 — CID 110919550
N'-[2-(1H-indol-3-yl)ethyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 110919550) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N'-[2-(1H-indol-3-yl)ethyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(1H-indol-3-yl)ethyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110919550 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N'-[2-(1H-indol-3-yl)ethyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C17H24N4/c1-13-7-10-21(11-8-13)17(18)19-9-6-14-12-20-16-5-3-2-4-15(14)16/h2-5,12-13,20H,6-11H2,1H3,(H2,18,19) |
| InChIKey | YSYICMILQTTWQT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|