C18H26N4 — CID 111108923
N'-[3-(1H-indol-3-yl)propyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 111108923) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N'-[3-(1H-indol-3-yl)propyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[3-(1H-indol-3-yl)propyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111108923 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N'-[3-(1H-indol-3-yl)propyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CCCc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C18H26N4/c1-14-8-11-22(12-9-14)18(19)20-10-4-5-15-13-21-17-7-3-2-6-16(15)17/h2-3,6-7,13-14,21H,4-5,8-12H2,1H3,(H2,19,20) |
| InChIKey | MPFXYPPNFRBKFJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|