C14H19BrFN3 — CID 110920809
N'-[(3-bromo-5-fluorophenyl)methyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 110920809) has the molecular formula C14H19BrFN3 and a molecular weight of 328.23 g/mol. Its IUPAC name is N'-[(3-bromo-5-fluorophenyl)methyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[(3-bromo-5-fluorophenyl)methyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110920809 |
| Molecular Formula | C14H19BrFN3 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N'-[(3-bromo-5-fluorophenyl)methyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/Cc2cc(F)cc(Br)c2)CC1 |
| InChI | InChI=1S/C14H19BrFN3/c1-10-2-4-19(5-3-10)14(17)18-9-11-6-12(15)8-13(16)7-11/h6-8,10H,2-5,9H2,1H3,(H2,17,18) |
| InChIKey | FRYLRXZYYAHYSB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|