C10H22IN3S — CID 110926968
4-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 110926968) has the molecular formula C10H22IN3S and a molecular weight of 343.28 g/mol. Its IUPAC name is 4-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110926968 |
| Molecular Formula | C10H22IN3S |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 4-methyl-N'-(2-methylsulfanylethyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CSCC/N=C(\N)N1CCC(C)CC1.I |
| InChI | InChI=1S/C10H21N3S.HI/c1-9-3-6-13(7-4-9)10(11)12-5-8-14-2;/h9H,3-8H2,1-2H3,(H2,11,12);1H |
| InChIKey | AUMLQXVNZCQUKX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|