C12H27IN4 — CID 110920495
N'-[2-[ethyl(methyl)amino]ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 110920495) has the molecular formula C12H27IN4 and a molecular weight of 354.28 g/mol. Its IUPAC name is N'-[2-[ethyl(methyl)amino]ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[ethyl(methyl)amino]ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110920495 |
| Molecular Formula | C12H27IN4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N'-[2-[ethyl(methyl)amino]ethyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN(C)CC/N=C(\N)N1CCC(C)CC1.I |
| InChI | InChI=1S/C12H26N4.HI/c1-4-15(3)10-7-14-12(13)16-8-5-11(2)6-9-16;/h11H,4-10H2,1-3H3,(H2,13,14);1H |
| InChIKey | AKLUNFWFUCMJSR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|