C16H29N3O4 — CID 132776814
ethyl 4-[(3-carbamoyl-3-methylpiperidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 132776814) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is ethyl 4-[(3-carbamoyl-3-methylpiperidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3-carbamoyl-3-methylpiperidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 132776814 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | ethyl 4-[(3-carbamoyl-3-methylpiperidin-1-yl)methyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(O)(CN2CCCC(C)(C(N)=O)C2)CC1 |
| InChI | InChI=1S/C16H29N3O4/c1-3-23-14(21)19-9-6-16(22,7-10-19)12-18-8-4-5-15(2,11-18)13(17)20/h22H,3-12H2,1-2H3,(H2,17,20) |
| InChIKey | WBNXBJGJYIUDQV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |