C14H24N2O2S — CID 107769150
N-[1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide (PubChem CID 107769150) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is N-[1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide.
| Compound Name | N-[1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 107769150 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-[1-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1-oxo-3-sulfanylpropan-2-yl]acetamide |
| SMILES | CC(=O)NC(CS)C(=O)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C14H24N2O2S/c1-10(17)15-13(9-19)14(18)16-7-6-11-4-2-3-5-12(11)8-16/h11-13,19H,2-9H2,1H3,(H,15,17) |
| InChIKey | UURIZOLVNLYFDI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|