C16H29N2O6P — CID 130364844
[(2S)-2-acetamido-3-(4-cyclohexylpiperidin-1-yl)-3-oxopropyl] dihydrogen phosphate (PubChem CID 130364844) has the molecular formula C16H29N2O6P and a molecular weight of 376.39 g/mol. Its IUPAC name is [(2S)-2-acetamido-3-(4-cyclohexylpiperidin-1-yl)-3-oxopropyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-acetamido-3-(4-cyclohexylpiperidin-1-yl)-3-oxopropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 130364844 |
| Molecular Formula | C16H29N2O6P |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [(2S)-2-acetamido-3-(4-cyclohexylpiperidin-1-yl)-3-oxopropyl] dihydrogen phosphate |
| SMILES | CC(=O)N[C@@H](COP(=O)(O)O)C(=O)N1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H29N2O6P/c1-12(19)17-15(11-24-25(21,22)23)16(20)18-9-7-14(8-10-18)13-5-3-2-4-6-13/h13-15H,2-11H2,1H3,(H,17,19)(H2,21,22,23)/t15-/m0/s1 |
| InChIKey | PWZNRZYQKQIYMR-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|