C17H31N2O5P — CID 130364790
[(3S)-3-acetamido-4-(4-cyclohexylpiperidin-1-yl)-4-oxobutyl]phosphonic acid (PubChem CID 130364790) has the molecular formula C17H31N2O5P and a molecular weight of 374.42 g/mol. Its IUPAC name is [(3S)-3-acetamido-4-(4-cyclohexylpiperidin-1-yl)-4-oxobutyl]phosphonic acid.
| Compound Name | [(3S)-3-acetamido-4-(4-cyclohexylpiperidin-1-yl)-4-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 130364790 |
| Molecular Formula | C17H31N2O5P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [(3S)-3-acetamido-4-(4-cyclohexylpiperidin-1-yl)-4-oxobutyl]phosphonic acid |
| SMILES | CC(=O)N[C@@H](CCP(=O)(O)O)C(=O)N1CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C17H31N2O5P/c1-13(20)18-16(9-12-25(22,23)24)17(21)19-10-7-15(8-11-19)14-5-3-2-4-6-14/h14-16H,2-12H2,1H3,(H,18,20)(H2,22,23,24)/t16-/m0/s1 |
| InChIKey | UYORZEHPBFOXIR-INIZCTEOSA-N |
| XLogP | 1.88 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|