C16H20F3N2O7P — CID 130364808
[1-oxo-3-phosphonooxy-1-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-2-yl]carbamic acid (PubChem CID 130364808) has the molecular formula C16H20F3N2O7P and a molecular weight of 440.31 g/mol. Its IUPAC name is [1-oxo-3-phosphonooxy-1-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-2-yl]carbamic acid.
| Compound Name | [1-oxo-3-phosphonooxy-1-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 130364808 |
| Molecular Formula | C16H20F3N2O7P |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [1-oxo-3-phosphonooxy-1-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]propan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(COP(=O)(O)O)C(=O)N1CCC(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H20F3N2O7P/c17-16(18,19)12-3-1-10(2-4-12)11-5-7-21(8-6-11)14(22)13(20-15(23)24)9-28-29(25,26)27/h1-4,11,13,20H,5-9H2,(H,23,24)(H2,25,26,27) |
| InChIKey | JLWNPCRONADEGY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|