C20H26F3N4O4P — CID 130364784
[(3S)-3-(4-ethyltriazol-1-yl)-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid (PubChem CID 130364784) has the molecular formula C20H26F3N4O4P and a molecular weight of 474.42 g/mol. Its IUPAC name is [(3S)-3-(4-ethyltriazol-1-yl)-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid.
| Compound Name | [(3S)-3-(4-ethyltriazol-1-yl)-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid |
|---|---|
| PubChem CID | 130364784 |
| Molecular Formula | C20H26F3N4O4P |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [(3S)-3-(4-ethyltriazol-1-yl)-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid |
| SMILES | CCc1cn([C@@H](CCP(=O)(O)O)C(=O)N2CCC(c3ccc(C(F)(F)F)cc3)CC2)nn1 |
| InChI | InChI=1S/C20H26F3N4O4P/c1-2-17-13-27(25-24-17)18(9-12-32(29,30)31)19(28)26-10-7-15(8-11-26)14-3-5-16(6-4-14)20(21,22)23/h3-6,13,15,18H,2,7-12H2,1H3,(H2,29,30,31)/t18-/m0/s1 |
| InChIKey | OXTAMAMOYKXRPJ-SFHVURJKSA-N |
| XLogP | 3.37 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|