C19H25F3N5O5P — CID 130364838
[3-(2-ethyltetrazol-5-yl)-3-hydroxy-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid (PubChem CID 130364838) has the molecular formula C19H25F3N5O5P and a molecular weight of 491.41 g/mol. Its IUPAC name is [3-(2-ethyltetrazol-5-yl)-3-hydroxy-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid.
| Compound Name | [3-(2-ethyltetrazol-5-yl)-3-hydroxy-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid |
|---|---|
| PubChem CID | 130364838 |
| Molecular Formula | C19H25F3N5O5P |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [3-(2-ethyltetrazol-5-yl)-3-hydroxy-4-oxo-4-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]butyl]phosphonic acid |
| SMILES | CCn1nnc(C(O)(CCP(=O)(O)O)C(=O)N2CCC(c3ccc(C(F)(F)F)cc3)CC2)n1 |
| InChI | InChI=1S/C19H25F3N5O5P/c1-2-27-24-16(23-25-27)18(29,9-12-33(30,31)32)17(28)26-10-7-14(8-11-26)13-3-5-15(6-4-13)19(20,21)22/h3-6,14,29H,2,7-12H2,1H3,(H2,30,31,32) |
| InChIKey | GEKYVWJOPRLHFG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|