C16H18F3NO3S — CID 120551044
2-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]sulfanylacetic acid (PubChem CID 120551044) has the molecular formula C16H18F3NO3S and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]sulfanylacetic acid.
| Compound Name | 2-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 120551044 |
| Molecular Formula | C16H18F3NO3S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[2-oxo-2-[4-[4-(trifluoromethyl)phenyl]piperidin-1-yl]ethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)N1CCC(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F3NO3S/c17-16(18,19)13-3-1-11(2-4-13)12-5-7-20(8-6-12)14(21)9-24-10-15(22)23/h1-4,12H,5-10H2,(H,22,23) |
| InChIKey | UPQSBGVKLOEPKW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |