C15H27N3O3 — CID 81199790
methyl 2-acetamido-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate (PubChem CID 81199790) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is methyl 2-acetamido-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate.
| Compound Name | methyl 2-acetamido-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate |
|---|---|
| PubChem CID | 81199790 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | methyl 2-acetamido-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate |
| SMILES | COC(=O)C(CN1CCC2C(CCCN2C)C1)NC(C)=O |
| InChI | InChI=1S/C15H27N3O3/c1-11(19)16-13(15(20)21-3)10-18-8-6-14-12(9-18)5-4-7-17(14)2/h12-14H,4-10H2,1-3H3,(H,16,19) |
| InChIKey | LRBSNIGUYCPDEB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |