C13H23BrN2O2 — CID 81199531
methyl 2-bromo-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate (PubChem CID 81199531) has the molecular formula C13H23BrN2O2 and a molecular weight of 319.24 g/mol. Its IUPAC name is methyl 2-bromo-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate.
| Compound Name | methyl 2-bromo-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate |
|---|---|
| PubChem CID | 81199531 |
| Molecular Formula | C13H23BrN2O2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | methyl 2-bromo-3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)propanoate |
| SMILES | COC(=O)C(Br)CN1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C13H23BrN2O2/c1-15-6-3-4-10-8-16(7-5-12(10)15)9-11(14)13(17)18-2/h10-12H,3-9H2,1-2H3 |
| InChIKey | RLRCEYVCVBGPDI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|