C13H22N2O5 — CID 11087384
methyl 1-(2-acetamido-3-methoxy-3-oxopropyl)piperidine-3-carboxylate (PubChem CID 11087384) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl 1-(2-acetamido-3-methoxy-3-oxopropyl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(2-acetamido-3-methoxy-3-oxopropyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 11087384 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | methyl 1-(2-acetamido-3-methoxy-3-oxopropyl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(CC(NC(C)=O)C(=O)OC)C1 |
| InChI | InChI=1S/C13H22N2O5/c1-9(16)14-11(13(18)20-3)8-15-6-4-5-10(7-15)12(17)19-2/h10-11H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | JDMHAWFEBAVSCA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |