C13H25NO4 — CID 79038191
methyl (3S)-1-(2-hydroxy-3-propan-2-yloxypropyl)piperidine-3-carboxylate (PubChem CID 79038191) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is methyl (3S)-1-(2-hydroxy-3-propan-2-yloxypropyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(2-hydroxy-3-propan-2-yloxypropyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 79038191 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | methyl (3S)-1-(2-hydroxy-3-propan-2-yloxypropyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(CC(O)COC(C)C)C1 |
| InChI | InChI=1S/C13H25NO4/c1-10(2)18-9-12(15)8-14-6-4-5-11(7-14)13(16)17-3/h10-12,15H,4-9H2,1-3H3/t11-,12?/m0/s1 |
| InChIKey | YFXYQFWKWCMVBN-PXYINDEMSA-N |
| XLogP | 0.66 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |