C12H22N2O5 — CID 103535255
methyl 2-acetamido-3-(3,4-dimethoxypyrrolidin-1-yl)propanoate (PubChem CID 103535255) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3,4-dimethoxypyrrolidin-1-yl)propanoate.
| Compound Name | methyl 2-acetamido-3-(3,4-dimethoxypyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 103535255 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | methyl 2-acetamido-3-(3,4-dimethoxypyrrolidin-1-yl)propanoate |
| SMILES | COC(=O)C(CN1CC(OC)C(OC)C1)NC(C)=O |
| InChI | InChI=1S/C12H22N2O5/c1-8(15)13-9(12(16)19-4)5-14-6-10(17-2)11(7-14)18-3/h9-11H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | QUBDGYMRTRGPAJ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |