C11H22N2O4 — CID 103538234
methyl 2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)butanoate (PubChem CID 103538234) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)butanoate.
| Compound Name | methyl 2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 103538234 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | methyl 2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)butanoate |
| SMILES | COC(=O)C(N)CCN1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C11H22N2O4/c1-15-9-6-13(7-10(9)16-2)5-4-8(12)11(14)17-3/h8-10H,4-7,12H2,1-3H3 |
| InChIKey | FEQJSOWVLQZWMH-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |