C11H23N3O2 — CID 114539347
methyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)propanoate (PubChem CID 114539347) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is methyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)propanoate.
| Compound Name | methyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)propanoate |
|---|---|
| PubChem CID | 114539347 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | methyl 2-amino-3-(3,4,5-trimethylpiperazin-1-yl)propanoate |
| SMILES | COC(=O)C(N)CN1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C11H23N3O2/c1-8-5-14(6-9(2)13(8)3)7-10(12)11(15)16-4/h8-10H,5-7,12H2,1-4H3 |
| InChIKey | FVZQJZIQDJGVTI-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |