C10H19ClN2O2 — CID 114540635
2-chloro-3-(3,4,5-trimethylpiperazin-1-yl)propanoic acid (PubChem CID 114540635) has the molecular formula C10H19ClN2O2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 2-chloro-3-(3,4,5-trimethylpiperazin-1-yl)propanoic acid.
| Compound Name | 2-chloro-3-(3,4,5-trimethylpiperazin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 114540635 |
| Molecular Formula | C10H19ClN2O2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-chloro-3-(3,4,5-trimethylpiperazin-1-yl)propanoic acid |
| SMILES | CC1CN(CC(Cl)C(=O)O)CC(C)N1C |
| InChI | InChI=1S/C10H19ClN2O2/c1-7-4-13(5-8(2)12(7)3)6-9(11)10(14)15/h7-9H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | YFGQYPBZUQIWNY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|