C11H23N3O2 — CID 114540817
4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid (PubChem CID 114540817) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid.
| Compound Name | 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 114540817 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid |
| SMILES | CC1CN(C(CCN)C(=O)O)CC(C)N1C |
| InChI | InChI=1S/C11H23N3O2/c1-8-6-14(7-9(2)13(8)3)10(4-5-12)11(15)16/h8-10H,4-7,12H2,1-3H3,(H,15,16) |
| InChIKey | VTFIZDPHAZGOLD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |