4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid

C11H23N3O2 — CID 114540817

IUPAC4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid
SMILESCC1CN(C(CCN)C(=O)O)CC(C)N1C
InChIInChI=1S/C11H23N3O2/c1-8-6-14(7-9(2)13(8)3)10(4-5-12)11(15)16/h8-10H,4-7,12H2,1-3H3,(H,15,16)
InChIKeyVTFIZDPHAZGOLD-UHFFFAOYSA-N
MW229.32 g/mol
LogP-0.19
Rot. Bonds4

About 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid

4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid (PubChem CID 114540817) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid.

Molecular Properties

Compound Name4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid
PubChem CID114540817
Molecular FormulaC11H23N3O2
Molecular Weight229.32 g/mol
Exact Mass229.18
IUPAC Name4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid
SMILESCC1CN(C(CCN)C(=O)O)CC(C)N1C
InChIInChI=1S/C11H23N3O2/c1-8-6-14(7-9(2)13(8)3)10(4-5-12)11(15)16/h8-10H,4-7,12H2,1-3H3,(H,15,16)
InChIKeyVTFIZDPHAZGOLD-UHFFFAOYSA-N
XLogP-0.19
TPSA69.80 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 5-0.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid?
The IUPAC name of 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid (CID 114540817) is 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid.
What is the SMILES notation for 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid?
The canonical SMILES for 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid is CC1CN(C(CCN)C(=O)O)CC(C)N1C.
What is the InChIKey of 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid?
The InChIKey is VTFIZDPHAZGOLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2/c1-8-6-14(7-9(2)13(8)3)10(4-5-12)11(15)16/h8-10H,4-7,12H2,1-3H3,(H,15,16).
What are the key properties of 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid?
4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid has a molecular weight of 229.32 g/mol, XLogP of -0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(3,4,5-trimethylpiperazin-1-yl)butanoic acid is sourced from PubChem (CID 114540817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).