C17H26N2O — CID 114538592
1-phenyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-one (PubChem CID 114538592) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-phenyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-one.
| Compound Name | 1-phenyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 114538592 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-phenyl-2-(3,4,5-trimethylpiperazin-1-yl)butan-1-one |
| SMILES | CCC(C(=O)c1ccccc1)N1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C17H26N2O/c1-5-16(17(20)15-9-7-6-8-10-15)19-11-13(2)18(4)14(3)12-19/h6-10,13-14,16H,5,11-12H2,1-4H3 |
| InChIKey | BOCZDNVQGRPAGZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |