C15H21NOS — CID 62030314
1-phenyl-2-(1,4-thiazepan-4-yl)butan-1-one (PubChem CID 62030314) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-phenyl-2-(1,4-thiazepan-4-yl)butan-1-one.
| Compound Name | 1-phenyl-2-(1,4-thiazepan-4-yl)butan-1-one |
|---|---|
| PubChem CID | 62030314 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-phenyl-2-(1,4-thiazepan-4-yl)butan-1-one |
| SMILES | CCC(C(=O)c1ccccc1)N1CCCSCC1 |
| InChI | InChI=1S/C15H21NOS/c1-2-14(16-9-6-11-18-12-10-16)15(17)13-7-4-3-5-8-13/h3-5,7-8,14H,2,6,9-12H2,1H3 |
| InChIKey | MLWLRYCOXRTYIN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |