C30H40N2O2 — CID 31275145
(2R,7R)-1,8-diphenyl-2,7-di(piperidin-1-yl)octane-1,8-dione (PubChem CID 31275145) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is (2R,7R)-1,8-diphenyl-2,7-di(piperidin-1-yl)octane-1,8-dione.
| Compound Name | (2R,7R)-1,8-diphenyl-2,7-di(piperidin-1-yl)octane-1,8-dione |
|---|---|
| PubChem CID | 31275145 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | (2R,7R)-1,8-diphenyl-2,7-di(piperidin-1-yl)octane-1,8-dione |
| SMILES | O=C(c1ccccc1)[C@@H](CCCC[C@H](C(=O)c1ccccc1)N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C30H40N2O2/c33-29(25-15-5-1-6-16-25)27(31-21-11-3-12-22-31)19-9-10-20-28(32-23-13-4-14-24-32)30(34)26-17-7-2-8-18-26/h1-2,5-8,15-18,27-28H,3-4,9-14,19-24H2/t27-,28-/m1/s1 |
| InChIKey | DZJVYYUUZFCXQS-VSGBNLITSA-N |
| XLogP | 6.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|